CAS 2008714-25-6 appears in our catalog under these names: Rac-(1s,2r,4r,6r)-6-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid, 95%, (1S,2R,4R,6R)-6-Hydroxy-7-oxabicyclo(2.2.1)heptane-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
(1S,2R,4R,6R)-6-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid (CAS 2008714-25-6) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: (1S,2R,4R,6R)-6-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: KUAZFQANFPDGSF-KAZBKCHUSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | (1S,2R,4R,6R)-6-hydroxy-7-oxabicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | KUAZFQANFPDGSF-KAZBKCHUSA-N |
| SMILES | C1[C@@H]2C[C@H]([C@H]([C@@H]1C(=O)O)O2)O |
Computed by PubChem (NCBI)