CAS 200956-53-2 is the registry number for 2-Bromo-1-(2,2,2-trifluoro-ethoxy)-4-trifluoromethyl-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-1-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)benzene (CAS 200956-53-2) is a chemical compound with the molecular formula C9H5BrF6O and a molecular weight of 323.03 g/mol. IUPAC name: 2-bromo-1-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)benzene. InChIKey: VHXAZODFTXNUOH-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6O |
|---|---|
| Molecular weight | 323.03 g/mol |
| IUPAC name | 2-bromo-1-(2,2,2-trifluoroethoxy)-4-(trifluoromethyl)benzene |
| InChIKey | VHXAZODFTXNUOH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)