CAS 52328-78-6 is the registry number for 4-Bromophenyl 1,1,2,3,3,3-hexafluoropropyl ether, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-bromo-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene (CAS 52328-78-6) is a chemical compound with the molecular formula C9H5BrF6O and a molecular weight of 323.03 g/mol. IUPAC name: 1-bromo-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene. InChIKey: LSBKOCQVEBDITK-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF6O |
|---|---|
| Molecular weight | 323.03 g/mol |
| IUPAC name | 1-bromo-4-(1,1,2,3,3,3-hexafluoropropoxy)benzene |
| InChIKey | LSBKOCQVEBDITK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(C(C(F)(F)F)F)(F)F)Br |
Computed by PubChem (NCBI)