CAS 2009598-15-4 is the registry number for [5-(3,4-Dichloro-phenyl)-thiophen-2-yl]-methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[5-(3,4-dichlorophenyl)thiophen-2-yl]methanol (CAS 2009598-15-4) is a chemical compound with the molecular formula C11H8Cl2OS and a molecular weight of 259.2 g/mol. IUPAC name: [5-(3,4-dichlorophenyl)thiophen-2-yl]methanol. InChIKey: ATHJJHCJSDEXFM-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2OS |
|---|---|
| Molecular weight | 259.2 g/mol |
| IUPAC name | [5-(3,4-dichlorophenyl)thiophen-2-yl]methanol |
| InChIKey | ATHJJHCJSDEXFM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC=C(S2)CO)Cl)Cl |
Computed by PubChem (NCBI)