CAS 255377-95-8 is the registry number for 4,6-Dichloro-2-methyl-2H-thiochromene-3-carbaldehyde, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-2-methyl-2H-thiochromene-3-carbaldehyde (CAS 255377-95-8) is a chemical compound with the molecular formula C11H8Cl2OS and a molecular weight of 259.2 g/mol. IUPAC name: 4,6-dichloro-2-methyl-2H-thiochromene-3-carbaldehyde. InChIKey: DMZWQXPJXXDQLU-UHFFFAOYSA-N.
| Molecular formula | C11H8Cl2OS |
|---|---|
| Molecular weight | 259.2 g/mol |
| IUPAC name | 4,6-dichloro-2-methyl-2H-thiochromene-3-carbaldehyde |
| InChIKey | DMZWQXPJXXDQLU-UHFFFAOYSA-N |
| SMILES | CC1C(=C(C2=C(S1)C=CC(=C2)Cl)Cl)C=O |
Computed by PubChem (NCBI)