CAS 201003-48-7 appears in our catalog under these names: Fmoc–Lys(Boc)(isopropyl)–OH, Fmoc-L-Lys(Boc, iPr)-OH, Fmoc-Lys(ipr,Boc)-OH 95%, N-Fmoc-N'-Boc-N'-isopropyl-L-lysine, 95%, 95%, Fmoc-Lys(ipr,Boc)-OH, 99.79%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1g, 25g, 5g, 250mg, 100g, 500g, 5 g, 1 g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]hexanoic acid (CAS 201003-48-7) is a chemical compound with the molecular formula C29H38N2O6 and a molecular weight of 510.6 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]hexanoic acid. InChIKey: LUGFCMICCJNLBC-VWLOTQADSA-N.
| Molecular formula | C29H38N2O6 |
|---|---|
| Molecular weight | 510.6 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonyl-propan-2-ylamino]hexanoic acid |
| InChIKey | LUGFCMICCJNLBC-VWLOTQADSA-N |
| SMILES | CC(C)N(CCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)