CAS 201466-87-7 is the registry number for N-(2,2,2-Trifluoroethyl)-3-(trifluoromethyl)aniline. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)aniline (CAS 201466-87-7) is a chemical compound with the molecular formula C9H7F6N and a molecular weight of 243.15 g/mol. IUPAC name: N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)aniline. InChIKey: OVIFIBWSSSOXLF-UHFFFAOYSA-N.
| Molecular formula | C9H7F6N |
|---|---|
| Molecular weight | 243.15 g/mol |
| IUPAC name | N-(2,2,2-trifluoroethyl)-3-(trifluoromethyl)aniline |
| InChIKey | OVIFIBWSSSOXLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NCC(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)