CAS 201531-21-7 appears in our catalog under these names: 2-Oxo-2,3-dihydrobenzo(d)oxazole-5-carbonitrile, 97%, 2-Oxo-2,3-Dihydrobenzo(d)oxazole-5-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-oxo-3H-1,3-benzoxazole-5-carbonitrile (CAS 201531-21-7) is a chemical compound with the molecular formula C8H4N2O2 and a molecular weight of 160.13 g/mol. IUPAC name: 2-oxo-3H-1,3-benzoxazole-5-carbonitrile. InChIKey: HGIWVOWYATXMHJ-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O2 |
|---|---|
| Molecular weight | 160.13 g/mol |
| IUPAC name | 2-oxo-3H-1,3-benzoxazole-5-carbonitrile |
| InChIKey | HGIWVOWYATXMHJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)NC(=O)O2 |
Computed by PubChem (NCBI)