CAS 952511-54-5 is the registry number for 2-Oxo-2,3-dihydro-1,3-benzoxazole-7-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-oxo-3H-1,3-benzoxazole-7-carbonitrile (CAS 952511-54-5) is a chemical compound with the molecular formula C8H4N2O2 and a molecular weight of 160.13 g/mol. IUPAC name: 2-oxo-3H-1,3-benzoxazole-7-carbonitrile. InChIKey: JGFRGKNPYPVQSQ-UHFFFAOYSA-N.
| Molecular formula | C8H4N2O2 |
|---|---|
| Molecular weight | 160.13 g/mol |
| IUPAC name | 2-oxo-3H-1,3-benzoxazole-7-carbonitrile |
| InChIKey | JGFRGKNPYPVQSQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=O)O2)C#N |
Computed by PubChem (NCBI)