CAS 201667-20-1 appears in our catalog under these names: Glycopyrrolate Erythro Isomer (SS-Isomer), Glycopyrrolate Impurity 11(Glycopyrrolate SS-Isomer), (2S,3’S)-Glycopyrrolate Bromide. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
[(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide (CAS 201667-20-1) is a chemical compound with the molecular formula C19H28BrNO3 and a molecular weight of 398.3 g/mol. IUPAC name: [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide. InChIKey: VPNYRYCIDCJBOM-JUOYHRLASA-M.
| Molecular formula | C19H28BrNO3 |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | [(3S)-1,1-dimethylpyrrolidin-1-ium-3-yl] (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
| InChIKey | VPNYRYCIDCJBOM-JUOYHRLASA-M |
| SMILES | C[N+]1(CC[C@@H](C1)OC(=O)[C@](C2CCCC2)(C3=CC=CC=C3)O)C.[Br-] |
Computed by PubChem (NCBI)