CAS 475468-09-8 appears in our catalog under these names: Glycopyrrolate, 95%, Glycopyrrolate Erythro Isomer (RR-Isomer), Glycopyrrolate Impurity 12(Glycopyrrolate RR-Isomer), (2R,3’R)-Glycopyrrolate Bromide, (3R)-3-(((2R)-2-Cyclopentyl-2-hydroxy-2-phenylacetyl)oxy)-1,1-dimethylpyrrolidinium bromide. Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: 100mg, 1g, on request, 10mg, 25mg, 50mg, 200mg, 250mg.
[(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide (CAS 475468-09-8) is a chemical compound with the molecular formula C19H28BrNO3 and a molecular weight of 398.3 g/mol. IUPAC name: [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide. InChIKey: VPNYRYCIDCJBOM-ZFNKBKEPSA-M.
| Molecular formula | C19H28BrNO3 |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | [(3R)-1,1-dimethylpyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
| InChIKey | VPNYRYCIDCJBOM-ZFNKBKEPSA-M |
| SMILES | C[N+]1(CC[C@H](C1)OC(=O)[C@@](C2CCCC2)(C3=CC=CC=C3)O)C.[Br-] |
Computed by PubChem (NCBI)