CAS 201733-11-1 appears in our catalog under these names: Bz-Asn-pNA, Bz–Asn–pNA. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 50mg, 250mg, 500mg, 1000mg.
(2S)-2-benzamido-N-(4-nitrophenyl)butanediamide (CAS 201733-11-1) is a chemical compound with the molecular formula C17H16N4O5 and a molecular weight of 356.33 g/mol. IUPAC name: (2S)-2-benzamido-N-(4-nitrophenyl)butanediamide. InChIKey: SLFUSGBNVYEJGY-AWEZNQCLSA-N.
| Molecular formula | C17H16N4O5 |
|---|---|
| Molecular weight | 356.33 g/mol |
| IUPAC name | (2S)-2-benzamido-N-(4-nitrophenyl)butanediamide |
| InChIKey | SLFUSGBNVYEJGY-AWEZNQCLSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CC(=O)N)C(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)