Products 7389-97-1

CAS 7389-97-1 is the registry number for Polaprezinc Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid (CAS 7389-97-1) is a chemical compound with the molecular formula C17H16N4O5 and a molecular weight of 356.33 g/mol. IUPAC name: (2S)-2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: PMMWFDIRNLJLDO-ZDUSSCGKSA-N.

Identity
Molecular formulaC17H16N4O5
Molecular weight356.33 g/mol
IUPAC name(2S)-2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-3-(1H-imidazol-5-yl)propanoic acid
InChIKeyPMMWFDIRNLJLDO-ZDUSSCGKSA-N
SMILESC1=CC=C2C(=C1)C(=O)N(C2=O)CCC(=O)N[C@@H](CC3=CN=CN3)C(=O)O

Computed by PubChem (NCBI)