CAS 201740-80-9 is the registry number for Boc-Leu-OH·H2O-13C. Offered by: MedChemExpress. Available pack sizes: 1mg, 5mg.
(2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino](113C)pentanoic acid;hydrate (CAS 201740-80-9) is a chemical compound with the molecular formula C11H23NO5 and a molecular weight of 250.30 g/mol. IUPAC name: (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino](113C)pentanoic acid;hydrate. InChIKey: URQQEIOTRWJXBA-GQSAWZRISA-N.
| Molecular formula | C11H23NO5 |
|---|---|
| Molecular weight | 250.30 g/mol |
| IUPAC name | (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino](113C)pentanoic acid;hydrate |
| InChIKey | URQQEIOTRWJXBA-GQSAWZRISA-N |
| SMILES | CC(C)C[C@@H]([13C](=O)O)NC(=O)OC(C)(C)C.O |
Computed by PubChem (NCBI)