CAS 20175-91-1 is the registry number for 3'-Hydroxy(1,2'-binaphthalene)-1',3,4,4'-tetrone. Offered by: TRC. Available pack sizes: 100mg.
3-(3,4-dioxonaphthalen-1-yl)-4-hydroxynaphthalene-1,2-dione (CAS 20175-91-1) is a chemical compound with the molecular formula C20H10O5 and a molecular weight of 330.3 g/mol. IUPAC name: 3-(3,4-dioxonaphthalen-1-yl)-4-hydroxynaphthalene-1,2-dione. InChIKey: QVWWAUPYZCEKMH-UHFFFAOYSA-N.
| Molecular formula | C20H10O5 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | 3-(3,4-dioxonaphthalen-1-yl)-4-hydroxynaphthalene-1,2-dione |
| InChIKey | QVWWAUPYZCEKMH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)C2=O)C3=C(C4=CC=CC=C4C(=O)C3=O)O |
Computed by PubChem (NCBI)