CAS 56119-07-4 appears in our catalog under these names: 3-Hydroxy-(2,2'-Binaphthalene)-1,1',4,4'-tetrone, Valdivione. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
3-(1,4-dioxonaphthalen-2-yl)-4-hydroxynaphthalene-1,2-dione (CAS 56119-07-4) is a chemical compound with the molecular formula C20H10O5 and a molecular weight of 330.3 g/mol. IUPAC name: 3-(1,4-dioxonaphthalen-2-yl)-4-hydroxynaphthalene-1,2-dione. InChIKey: WUZFCNSDGMHMKW-UHFFFAOYSA-N.
| Molecular formula | C20H10O5 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | 3-(1,4-dioxonaphthalen-2-yl)-4-hydroxynaphthalene-1,2-dione |
| InChIKey | WUZFCNSDGMHMKW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(C2=O)C3=C(C4=CC=CC=C4C(=O)C3=O)O |
Computed by PubChem (NCBI)