Products 201802-67-7

CAS 201802-67-7 appears in our catalog under these names: 4–(Diphenylamino)phenylboronic acid, 4-(Diphenylamino)phenylboronic Acid (contains varying amounts of Anhydride), 4-(Diphenylamino)benzeneboronic acid 98%, 4-(DIPHENYLAMINO)PHENYLBORONIC ACID, >=, 4-(Diphenylamino)phenylboronic acid, 99%, 99%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 100g, 25g, 5g, 1g, 10g, 500g, 1000g, 5kg.

Structural formula: {0} (CAS {1})

[4-(N-phenylanilino)phenyl]boronic acid (CAS 201802-67-7) is a chemical compound with the molecular formula C18H16BNO2 and a molecular weight of 289.1 g/mol. IUPAC name: [4-(N-phenylanilino)phenyl]boronic acid. InChIKey: TWWQCBRELPOMER-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16BNO2
Molecular weight289.1 g/mol
IUPAC name[4-(N-phenylanilino)phenyl]boronic acid
InChIKeyTWWQCBRELPOMER-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3)(O)O

Computed by PubChem (NCBI)