CAS 943899-12-5 appears in our catalog under these names: 3-(Diphenylamino)phenylboronic acid3-(Diphenylamino)phenylboronic acid, >97%, (3–(diphenylamino)phenyl)boronic acid, (3-(Diphenylamino)phenyl)boronic acid 95%, (3-(Diphenylamino)phenyl)boronic acid, 95%, 95%, (3-(Diphenylamino)phenyl)boronic acid, 98%. Offered by: Lumtec, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: On request, 1g, 5g, 250mg, 25g, 10g.
[3-(N-phenylanilino)phenyl]boronic acid (CAS 943899-12-5) is a chemical compound with the molecular formula C18H16BNO2 and a molecular weight of 289.1 g/mol. IUPAC name: [3-(N-phenylanilino)phenyl]boronic acid. InChIKey: MYCPKZJMLZZINQ-UHFFFAOYSA-N.
| Molecular formula | C18H16BNO2 |
|---|---|
| Molecular weight | 289.1 g/mol |
| IUPAC name | [3-(N-phenylanilino)phenyl]boronic acid |
| InChIKey | MYCPKZJMLZZINQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)