CAS 2018300-50-8 is the registry number for 4-tert-Butyl 9-methyl 7-bromo-2,3-dihydrobenzo[f][1,4]oxazepine-4,9(5h)-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-O-tert-butyl 9-O-methyl 7-bromo-3,5-dihydro-2H-1,4-benzoxazepine-4,9-dicarboxylate (CAS 2018300-50-8) is a chemical compound with the molecular formula C16H20BrNO5 and a molecular weight of 386.24 g/mol. IUPAC name: 4-O-tert-butyl 9-O-methyl 7-bromo-3,5-dihydro-2H-1,4-benzoxazepine-4,9-dicarboxylate. InChIKey: LBZYSDWKRGYYTK-UHFFFAOYSA-N.
| Molecular formula | C16H20BrNO5 |
|---|---|
| Molecular weight | 386.24 g/mol |
| IUPAC name | 4-O-tert-butyl 9-O-methyl 7-bromo-3,5-dihydro-2H-1,4-benzoxazepine-4,9-dicarboxylate |
| InChIKey | LBZYSDWKRGYYTK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C(C1)C=C(C=C2C(=O)OC)Br |
Computed by PubChem (NCBI)