CAS 93396-86-2 is the registry number for Methyl 2-(Acetylamino)-6-bromo-2,3,6-trideoxy-alpha-D-ribo-hexopyranoside 4-Benzoate. Offered by: TRC. Available pack sizes: 1g.
[(2S,3S,5R,6S)-5-acetamido-2-(bromomethyl)-6-methoxyoxan-3-yl] benzoate (CAS 93396-86-2) is a chemical compound with the molecular formula C16H20BrNO5 and a molecular weight of 386.24 g/mol. IUPAC name: [(2S,3S,5R,6S)-5-acetamido-2-(bromomethyl)-6-methoxyoxan-3-yl] benzoate. InChIKey: RRLODVPZWJDOPT-CTASWTNQSA-N.
| Molecular formula | C16H20BrNO5 |
|---|---|
| Molecular weight | 386.24 g/mol |
| IUPAC name | [(2S,3S,5R,6S)-5-acetamido-2-(bromomethyl)-6-methoxyoxan-3-yl] benzoate |
| InChIKey | RRLODVPZWJDOPT-CTASWTNQSA-N |
| SMILES | CC(=O)N[C@@H]1C[C@@H]([C@H](O[C@@H]1OC)CBr)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)