CAS 201847-52-1 appears in our catalog under these names: H-D-Ala-amc tfa, 95%, H–D–Ala–AMC · TFA, D-Alanine 7-amido-4-methylcoumarin trifluoroacetate salt, (R)-2-Amino-N-(4-methyl-2-oxo-2H-chromen-7-yl)propanamide 2,2,2-trifluoroacetate 95%, H-D-ALA-AMC TFA, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg, 1000mg, 2000mg.
(2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;2,2,2-trifluoroacetic acid (CAS 201847-52-1) is a chemical compound with the molecular formula C15H15F3N2O5 and a molecular weight of 360.28 g/mol. IUPAC name: (2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;2,2,2-trifluoroacetic acid. InChIKey: YYGKKBUKGNFDJW-DDWIOCJRSA-N.
| Molecular formula | C15H15F3N2O5 |
|---|---|
| Molecular weight | 360.28 g/mol |
| IUPAC name | (2R)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;2,2,2-trifluoroacetic acid |
| InChIKey | YYGKKBUKGNFDJW-DDWIOCJRSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@@H](C)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)