CAS 96594-10-4 appears in our catalog under these names: L-ALANINE 7-AMIDO-4-METHYLCOUMARIN, L-ALANINE 7-AMIDO-4-METHYLCOUMARIN &, L-Alanine 7-Amido-4-methylcoumarin, Trifluoroacetate Salt, L–Alanine 7–amido–4–methylcoumarin trifluoroacetate salt, L-Alanine-7-amido-4-methylcoumarin trifluoroacetate salt, 98%. Offered by: Sigma-Aldrich, TRC, GLPBio, Combi-blocks, Iris Biotech. Available pack sizes: 250MG, 25MG, 2,5g, 1g, 500mg, 5g, 25g, 50mg.
(2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;2,2,2-trifluoroacetic acid (CAS 96594-10-4) is a chemical compound with the molecular formula C15H15F3N2O5 and a molecular weight of 360.28 g/mol. IUPAC name: (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;2,2,2-trifluoroacetic acid. InChIKey: YYGKKBUKGNFDJW-QRPNPIFTSA-N.
| Molecular formula | C15H15F3N2O5 |
|---|---|
| Molecular weight | 360.28 g/mol |
| IUPAC name | (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)propanamide;2,2,2-trifluoroacetic acid |
| InChIKey | YYGKKBUKGNFDJW-QRPNPIFTSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](C)N.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)