CAS 201858-51-7 is the registry number for 4-(2-(4-(Dimethyliminio)cyclohexa-2,5-dien-1-ylidene)hydrazinyl)benzoate, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid (CAS 201858-51-7) is a chemical compound with the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. IUPAC name: 4-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid. InChIKey: WCKQPPQRFNHPRJ-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O2 |
|---|---|
| Molecular weight | 269.30 g/mol |
| IUPAC name | 4-[[4-(dimethylamino)phenyl]diazenyl]benzoic acid |
| InChIKey | WCKQPPQRFNHPRJ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)