Products 201860-40-4
CAS 201860-40-4 is the registry number for H-Thr(tBu)-AMC · HCl. Offered by: Creative Peptides. Available pack sizes: 250mg, 1g.
(2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-3-[(2-methylpropan-2-yl)oxy]butanamide;hydrochloride (CAS 201860-40-4) is a chemical compound with the molecular formula C18H25ClN2O4 and a molecular weight of 368.9 g/mol. IUPAC name: (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-3-[(2-methylpropan-2-yl)oxy]butanamide;hydrochloride. InChIKey: MIUUJNXDEURWRL-DHYDJSQFSA-N.
| Molecular formula | C18H25ClN2O4 |
|---|---|
| Molecular weight | 368.9 g/mol |
| IUPAC name | (2S)-2-amino-N-(4-methyl-2-oxochromen-7-yl)-3-[(2-methylpropan-2-yl)oxy]butanamide;hydrochloride |
| InChIKey | MIUUJNXDEURWRL-DHYDJSQFSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](C(C)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)