Products 2618829-93-7
CAS 2618829-93-7 is the registry number for rel-1-(tert-Butyl) 4-ethyl (3S,4R)-3-(5-chloropyridin-2-yl)piperidine-1,4-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 4-O-ethyl (3S,4R)-3-(5-chloro-2-pyridinyl)piperidine-1,4-dicarboxylate (CAS 2618829-93-7) is a chemical compound with the molecular formula C18H25ClN2O4 and a molecular weight of 368.9 g/mol. IUPAC name: 1-O-tert-butyl 4-O-ethyl (3S,4R)-3-(5-chloro-2-pyridinyl)piperidine-1,4-dicarboxylate. InChIKey: IZGLONKWHVVTGY-ZIAGYGMSSA-N.
| Molecular formula | C18H25ClN2O4 |
|---|---|
| Molecular weight | 368.9 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-ethyl (3S,4R)-3-(5-chloro-2-pyridinyl)piperidine-1,4-dicarboxylate |
| InChIKey | IZGLONKWHVVTGY-ZIAGYGMSSA-N |
| SMILES | CCOC(=O)[C@@H]1CCN(C[C@H]1C2=NC=C(C=C2)Cl)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)