Products 1446819-29-9
CAS 1446819-29-9 is the registry number for tert-Butyl 4-(2-chloro-4-(methoxycarbonyl)benzyl)piperazine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 4-[(2-chloro-4-methoxycarbonylphenyl)methyl]piperazine-1-carboxylate (CAS 1446819-29-9) is a chemical compound with the molecular formula C18H25ClN2O4 and a molecular weight of 368.9 g/mol. IUPAC name: tert-butyl 4-[(2-chloro-4-methoxycarbonylphenyl)methyl]piperazine-1-carboxylate. InChIKey: XYUGXPRRGWQUGE-UHFFFAOYSA-N.
| Molecular formula | C18H25ClN2O4 |
|---|---|
| Molecular weight | 368.9 g/mol |
| IUPAC name | tert-butyl 4-[(2-chloro-4-methoxycarbonylphenyl)methyl]piperazine-1-carboxylate |
| InChIKey | XYUGXPRRGWQUGE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)CC2=C(C=C(C=C2)C(=O)OC)Cl |
Computed by PubChem (NCBI)