Products 20187-73-9
CAS 20187-73-9 is the registry number for Methyl 2-deoxy-2-fluoro-D-arabinofuranoside. Offered by: Biosynth. Available pack sizes: 100mg.
(2R,3R,4S,5S)-4-fluoro-2-(hydroxymethyl)-5-methoxyoxolan-3-ol (CAS 20187-73-9) is a chemical compound with the molecular formula C6H11FO4 and a molecular weight of 166.15 g/mol. IUPAC name: (2R,3R,4S,5S)-4-fluoro-2-(hydroxymethyl)-5-methoxyoxolan-3-ol. InChIKey: ULRUFWVRASYVEG-MOJAZDJTSA-N.
| Molecular formula | C6H11FO4 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | (2R,3R,4S,5S)-4-fluoro-2-(hydroxymethyl)-5-methoxyoxolan-3-ol |
| InChIKey | ULRUFWVRASYVEG-MOJAZDJTSA-N |
| SMILES | CO[C@@H]1[C@H]([C@@H]([C@H](O1)CO)O)F |
Computed by PubChem (NCBI)