CAS 442514-57-0 appears in our catalog under these names: (2S,3S,4R)–4–fluoro–2–(hydroxymethyl)–5–methoxytetrahydrofuran–3–ol, Methyl 2-deoxy-2-fluoro-L-arabinofuranoside. Offered by: GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 50mg, 0,025g, 500mg.
(2S,3S,4R)-4-fluoro-2-(hydroxymethyl)-5-methoxyoxolan-3-ol (CAS 442514-57-0) is a chemical compound with the molecular formula C6H11FO4 and a molecular weight of 166.15 g/mol. IUPAC name: (2S,3S,4R)-4-fluoro-2-(hydroxymethyl)-5-methoxyoxolan-3-ol. InChIKey: ULRUFWVRASYVEG-AMVSKUEXSA-N.
| Molecular formula | C6H11FO4 |
|---|---|
| Molecular weight | 166.15 g/mol |
| IUPAC name | (2S,3S,4R)-4-fluoro-2-(hydroxymethyl)-5-methoxyoxolan-3-ol |
| InChIKey | ULRUFWVRASYVEG-AMVSKUEXSA-N |
| SMILES | COC1[C@@H]([C@H]([C@@H](O1)CO)O)F |
Computed by PubChem (NCBI)