CAS 201996-37-4 appears in our catalog under these names: Gimeracil Impurity 4-13C3 (Cyanuric Acid-13C3), Cyanuric Acid-13C3, >95% (HPLC), Cyanuric acid-13C3, Cyanuric acid–13C3, CYANURSDURE-13C3. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Sigma-Aldrich. Available pack sizes: on request, 50mg, 5mg, 1mg, 10mg, 1 mg, 5 mg, 10 mg.
(2,4,6-13C3)1,3,5-triazinane-2,4,6-trione (CAS 201996-37-4) is a chemical compound with the molecular formula C3H3N3O3 and a molecular weight of 132.05 g/mol. IUPAC name: (2,4,6-13C3)1,3,5-triazinane-2,4,6-trione. InChIKey: ZFSLODLOARCGLH-VMIGTVKRSA-N.
| Molecular formula | C3H3N3O3 |
|---|---|
| Molecular weight | 132.05 g/mol |
| IUPAC name | (2,4,6-13C3)1,3,5-triazinane-2,4,6-trione |
| InChIKey | ZFSLODLOARCGLH-VMIGTVKRSA-N |
| SMILES | [13C]1(=O)N[13C](=O)N[13C](=O)N1 |
Computed by PubChem (NCBI)