Products 4970-61-0

CAS 4970-61-0 appears in our catalog under these names: 5-Amino-1,3,4-oxadiazole-2-carboxylic acid 95%, 5-Amino-1,3,4-oxadiazole-2-carboxylic acid, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

5-amino-1,3,4-oxadiazole-2-carboxylic acid (CAS 4970-61-0) is a chemical compound with the molecular formula C3H3N3O3 and a molecular weight of 129.07 g/mol. IUPAC name: 5-amino-1,3,4-oxadiazole-2-carboxylic acid. InChIKey: CDCSNJVXRRSDFF-UHFFFAOYSA-N.

Identity
Molecular formulaC3H3N3O3
Molecular weight129.07 g/mol
IUPAC name5-amino-1,3,4-oxadiazole-2-carboxylic acid
InChIKeyCDCSNJVXRRSDFF-UHFFFAOYSA-N
SMILESC1(=NN=C(O1)N)C(=O)O

Computed by PubChem (NCBI)