CAS 20200-86-6 appears in our catalog under these names: 1,3,3-Trimethylindolin-2-one, 95%, 1,3,3-Trimethylindolin-2-one, 96%, 96%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g.
1,3,3-trimethylindol-2-one (CAS 20200-86-6) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 1,3,3-trimethylindol-2-one. InChIKey: RFJITKCIMOLCNP-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 1,3,3-trimethylindol-2-one |
| InChIKey | RFJITKCIMOLCNP-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC=CC=C2N(C1=O)C)C |
Computed by PubChem (NCBI)