Products 2021809-76-5
CAS 2021809-76-5 appears in our catalog under these names: 7-Bromo-8-chloro-1,2-dihydroquinolin-2-one, 95%, 7-Bromo-8-chloro-1,2-dihydroquinolin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
7-bromo-8-chloro-1H-quinolin-2-one (CAS 2021809-76-5) is a chemical compound with the molecular formula C9H5BrClNO and a molecular weight of 258.50 g/mol. IUPAC name: 7-bromo-8-chloro-1H-quinolin-2-one. InChIKey: PEUZREMYKSIZOP-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClNO |
|---|---|
| Molecular weight | 258.50 g/mol |
| IUPAC name | 7-bromo-8-chloro-1H-quinolin-2-one |
| InChIKey | PEUZREMYKSIZOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CC(=O)N2)Cl)Br |
Computed by PubChem (NCBI)