Products 2022222-86-0
CAS 2022222-86-0 is the registry number for 2–(9H–Carbazol–3–yl)–5–phenyl–5H–benzo(b)carbazole. Offered by: GLPBio. Available pack sizes: 25g, 5g.
2-(9H-carbazol-3-yl)-5-phenylbenzo[b]carbazole (CAS 2022222-86-0) is a chemical compound with the molecular formula C34H22N2 and a molecular weight of 458.5 g/mol. IUPAC name: 2-(9H-carbazol-3-yl)-5-phenylbenzo[b]carbazole. InChIKey: XQZDOLZLLANQDU-UHFFFAOYSA-N.
| Molecular formula | C34H22N2 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | 2-(9H-carbazol-3-yl)-5-phenylbenzo[b]carbazole |
| InChIKey | XQZDOLZLLANQDU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)C4=CC5=C(C=C4)NC6=CC=CC=C65)C7=CC8=CC=CC=C8C=C72 |
Computed by PubChem (NCBI)