CAS 923972-84-3 appears in our catalog under these names: 2-(Naphthalen-2-yl)-4,7-diphenyl-1,10-phenanthroline, 97%, Poly((9,9-dihexylfluorenyl-2,7-diyl)-alt-(2-methoxy-5-{2-ethylhexyloxy}-1,4-phenylene)). Offered by: Chemat Brand, Lumtec. Available pack sizes: on request.
2-naphthalen-2-yl-4,7-diphenyl-1,10-phenanthroline (CAS 923972-84-3) is a chemical compound with the molecular formula C34H22N2 and a molecular weight of 458.5 g/mol. IUPAC name: 2-naphthalen-2-yl-4,7-diphenyl-1,10-phenanthroline. InChIKey: CELPGKFEUDCZOU-UHFFFAOYSA-N.
| Molecular formula | C34H22N2 |
|---|---|
| Molecular weight | 458.5 g/mol |
| IUPAC name | 2-naphthalen-2-yl-4,7-diphenyl-1,10-phenanthroline |
| InChIKey | CELPGKFEUDCZOU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC4=C(C3=NC=C2)N=C(C=C4C5=CC=CC=C5)C6=CC7=CC=CC=C7C=C6 |
Computed by PubChem (NCBI)