CAS 202271-70-3 is the registry number for tert-Butyl D-glutaminate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R)-2,5-diamino-5-oxopentanoate (CAS 202271-70-3) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl (2R)-2,5-diamino-5-oxopentanoate. InChIKey: VVOPSEUXHSUTJS-ZCFIWIBFSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl (2R)-2,5-diamino-5-oxopentanoate |
| InChIKey | VVOPSEUXHSUTJS-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCC(=O)N)N |
Computed by PubChem (NCBI)