Products 202337-44-8
CAS 202337-44-8 is the registry number for 6–O–(p–Hydroxybenzoyl)glucose. Offered by: GLPBio. Available pack sizes: 5mg.
[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] 4-hydroxybenzoate (CAS 202337-44-8) is a chemical compound with the molecular formula C13H16O8 and a molecular weight of 300.26 g/mol. IUPAC name: [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] 4-hydroxybenzoate. InChIKey: HELXVRZEFXGLOR-IRCOFANPSA-N.
| Molecular formula | C13H16O8 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | [(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexyl] 4-hydroxybenzoate |
| InChIKey | HELXVRZEFXGLOR-IRCOFANPSA-N |
| SMILES | C1=CC(=CC=C1C(=O)OC[C@H]([C@H]([C@@H]([C@H](C=O)O)O)O)O)O |
Computed by PubChem (NCBI)