CAS 81742-15-6 is the registry number for 2-Hydroxy-4-methylphenyl beta-D-glucopyranosiduronic Acid. Offered by: TRC. Available pack sizes: 100mg.
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-hydroxy-4-methylphenoxy)oxane-2-carboxylic acid (CAS 81742-15-6) is a chemical compound with the molecular formula C13H16O8 and a molecular weight of 300.26 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-hydroxy-4-methylphenoxy)oxane-2-carboxylic acid. InChIKey: PLHZIQGSGAGOQO-XPORZQOISA-N.
| Molecular formula | C13H16O8 |
|---|---|
| Molecular weight | 300.26 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(2-hydroxy-4-methylphenoxy)oxane-2-carboxylic acid |
| InChIKey | PLHZIQGSGAGOQO-XPORZQOISA-N |
| SMILES | CC1=CC(=C(C=C1)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C(=O)O)O)O)O)O |
Computed by PubChem (NCBI)