CAS 202345-41-3 is the registry number for 4(2)-Bromo-1,4(1,4)-dibenzenacyclohexaphan-1(2)-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
12-bromotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaen-5-amine (CAS 202345-41-3) is a chemical compound with the molecular formula C16H16BrN and a molecular weight of 302.21 g/mol. IUPAC name: 12-bromotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaen-5-amine. InChIKey: GBLHBYBIRQCNHI-UHFFFAOYSA-N.
| Molecular formula | C16H16BrN |
|---|---|
| Molecular weight | 302.21 g/mol |
| IUPAC name | 12-bromotricyclo[8.2.2.24,7]hexadeca-1(12),4,6,10,13,15-hexaen-5-amine |
| InChIKey | GBLHBYBIRQCNHI-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(CCC3=C(C=C1C=C3)N)C=C2)Br |
Computed by PubChem (NCBI)