Products 885438-74-4
CAS 885438-74-4 is the registry number for 1-[(4-Bromophenyl)methyl]-1,2,3,4-tetrahydroquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-[(4-bromophenyl)methyl]-3,4-dihydro-2H-quinoline (CAS 885438-74-4) is a chemical compound with the molecular formula C16H16BrN and a molecular weight of 302.21 g/mol. IUPAC name: 1-[(4-bromophenyl)methyl]-3,4-dihydro-2H-quinoline. InChIKey: AFRCKJAHIYTMAF-UHFFFAOYSA-N.
| Molecular formula | C16H16BrN |
|---|---|
| Molecular weight | 302.21 g/mol |
| IUPAC name | 1-[(4-bromophenyl)methyl]-3,4-dihydro-2H-quinoline |
| InChIKey | AFRCKJAHIYTMAF-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C1)CC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)