CAS 2024588-68-7 is the registry number for (alphaR)-alpha-((Phenylmethoxy)methyl)-(1,1'-biphenyl)-4-ethanamine hydrochloride. Offered by: TRC. Available pack sizes: 500mg.
(2R)-1-phenylmethoxy-3-(4-phenylphenyl)propan-2-amine;hydrochloride (CAS 2024588-68-7) is a chemical compound with the molecular formula C22H24ClNO and a molecular weight of 353.9 g/mol. IUPAC name: (2R)-1-phenylmethoxy-3-(4-phenylphenyl)propan-2-amine;hydrochloride. InChIKey: QKEIUJTZZPFEHE-VZYDHVRKSA-N.
| Molecular formula | C22H24ClNO |
|---|---|
| Molecular weight | 353.9 g/mol |
| IUPAC name | (2R)-1-phenylmethoxy-3-(4-phenylphenyl)propan-2-amine;hydrochloride |
| InChIKey | QKEIUJTZZPFEHE-VZYDHVRKSA-N |
| SMILES | C1=CC=C(C=C1)COC[C@@H](CC2=CC=C(C=C2)C3=CC=CC=C3)N.Cl |
Computed by PubChem (NCBI)