CAS 95130-23-7 appears in our catalog under these names: BCI HCl, 98%, BCI hydrochloride, BCI hydrochloride, (E/Z)-BCI HYDROCHLORIDE, 2-Benzylidene-3-(cyclohexylamino)-2,3-dihydro-1H-inden-1-one hydrochloride. Offered by: AmBeed, TargetMol, GLPBio, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 2mg, 1mg, 10mg, 10mM (in 1ml dmso), 5mg, 25MG, 50 mg.
(2E)-2-benzylidene-3-(cyclohexylamino)-3H-inden-1-one;hydrochloride (CAS 95130-23-7) is a chemical compound with the molecular formula C22H24ClNO and a molecular weight of 353.9 g/mol. IUPAC name: (2E)-2-benzylidene-3-(cyclohexylamino)-3H-inden-1-one;hydrochloride. InChIKey: JPATUDRDKCLPTI-QMGGKDRNSA-N.
| Molecular formula | C22H24ClNO |
|---|---|
| Molecular weight | 353.9 g/mol |
| IUPAC name | (2E)-2-benzylidene-3-(cyclohexylamino)-3H-inden-1-one;hydrochloride |
| InChIKey | JPATUDRDKCLPTI-QMGGKDRNSA-N |
| SMILES | C1CCC(CC1)NC\2C3=CC=CC=C3C(=O)/C2=C/C4=CC=CC=C4.Cl |
Computed by PubChem (NCBI)