CAS 202468-35-7 appears in our catalog under these names: L-Isoleucine-13C6,15N, 98% 98%atom%13C,98%atom%15N, L-Isoleucine-13C6, 15N, >95% (HPLC), L-Isoleucine-13C6,15N, 98.0%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 5 mg, 50 mg, 100 mg, 25 mg.
(2R,3S)-2-(15N)azanyl-3-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid (CAS 202468-35-7) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 138.12 g/mol. IUPAC name: (2R,3S)-2-(15N)azanyl-3-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid. InChIKey: AGPKZVBTJJNPAG-JZHNXQILSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 138.12 g/mol |
| IUPAC name | (2R,3S)-2-(15N)azanyl-3-(113C)methyl(1,2,3,4,5-13C5)pentanoic acid |
| InChIKey | AGPKZVBTJJNPAG-JZHNXQILSA-N |
| SMILES | [13CH3][13CH2][13C@H]([13CH3])[13C@H]([13C](=O)O)[15NH2] |
Computed by PubChem (NCBI)