Products 29909-02-2
CAS 29909-02-2 appears in our catalog under these names: Isoleucine-d10 (mixture of diastereomers), Isoleucine-d10 (mixture of diastereomers), 99 atom % D, min 98% Chemical Purity, DL–Isoleucine–d10, DL-Isoleucine-d10, 98.6%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 25mg, 5mg, 1 mg.
2-amino-2,3,4,4,5,5,5-heptadeuterio-3-(trideuteriomethyl)pentanoic acid (CAS 29909-02-2) is a chemical compound with the molecular formula C6H13NO2 and a molecular weight of 141.23 g/mol. IUPAC name: 2-amino-2,3,4,4,5,5,5-heptadeuterio-3-(trideuteriomethyl)pentanoic acid. InChIKey: AGPKZVBTJJNPAG-SHJFKSRGSA-N.
| Molecular formula | C6H13NO2 |
|---|---|
| Molecular weight | 141.23 g/mol |
| IUPAC name | 2-amino-2,3,4,4,5,5,5-heptadeuterio-3-(trideuteriomethyl)pentanoic acid |
| InChIKey | AGPKZVBTJJNPAG-SHJFKSRGSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])(C(=O)O)N |
Computed by PubChem (NCBI)