Products 202468-39-1
CAS 202468-39-1 appears in our catalog under these names: L–Threonine–13C4,15N, L-Threonine-¹³C₄,¹⁵N, ≥98 atom% 13C,≥98 atom% 15N, ≥98 atom% 13C,≥98 atom% 15N, L-Threonine-13C4,15N, 98.20%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 100mg, 50 mg, 25 mg, 10 mg, 5 mg.
(2S,3R)-2-(15N)azanyl-3-hydroxy(1,2,3,4-13C4)butanoic acid (CAS 202468-39-1) is a chemical compound with the molecular formula C4H9NO3 and a molecular weight of 124.084 g/mol. IUPAC name: (2S,3R)-2-(15N)azanyl-3-hydroxy(1,2,3,4-13C4)butanoic acid. InChIKey: AYFVYJQAPQTCCC-KJQIOZMZSA-N.
| Molecular formula | C4H9NO3 |
|---|---|
| Molecular weight | 124.084 g/mol |
| IUPAC name | (2S,3R)-2-(15N)azanyl-3-hydroxy(1,2,3,4-13C4)butanoic acid |
| InChIKey | AYFVYJQAPQTCCC-KJQIOZMZSA-N |
| SMILES | [13CH3][13C@H]([13C@@H]([13C](=O)O)[15NH2])O |
Computed by PubChem (NCBI)