Products 202526-51-0
CAS 202526-51-0 is the registry number for Sanggenol F. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,3,8,10a-tetrahydroxy-2,5a-bis(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one (CAS 202526-51-0) is a chemical compound with the molecular formula C25H26O7 and a molecular weight of 438.5 g/mol. IUPAC name: 1,3,8,10a-tetrahydroxy-2,5a-bis(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one. InChIKey: KDTSLDXCGUETMJ-UHFFFAOYSA-N.
| Molecular formula | C25H26O7 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 1,3,8,10a-tetrahydroxy-2,5a-bis(3-methylbut-2-enyl)-[1]benzofuro[3,2-b]chromen-11-one |
| InChIKey | KDTSLDXCGUETMJ-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C2=C(C=C1O)OC3(C4=C(C=C(C=C4)O)OC3(C2=O)O)CC=C(C)C)O)C |
Computed by PubChem (NCBI)
Synonyms:
Sanggenol F