Products 99119-73-0
CAS 99119-73-0 appears in our catalog under these names: Kushenol C, Kushenol C, 99.58%. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 1mg, 5mg, 5 mg, 1 mg.
2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]chromen-4-one (CAS 99119-73-0) is a chemical compound with the molecular formula C25H26O7 and a molecular weight of 438.5 g/mol. IUPAC name: 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]chromen-4-one. InChIKey: WAAPHYJTKSTXSX-CQSZACIVSA-N.
| Molecular formula | C25H26O7 |
|---|---|
| Molecular weight | 438.5 g/mol |
| IUPAC name | 2-(2,4-dihydroxyphenyl)-3,5,7-trihydroxy-8-[(2R)-5-methyl-2-prop-1-en-2-ylhex-4-enyl]chromen-4-one |
| InChIKey | WAAPHYJTKSTXSX-CQSZACIVSA-N |
| SMILES | CC(=CC[C@H](CC1=C2C(=C(C=C1O)O)C(=O)C(=C(O2)C3=C(C=C(C=C3)O)O)O)C(=C)C)C |
Computed by PubChem (NCBI)