CAS 202529-13-3 is the registry number for 3-Methylpyridine-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
2,3,4,6-tetradeuterio-5-(trideuteriomethyl)pyridine (CAS 202529-13-3) is a chemical compound with the molecular formula C6H7N and a molecular weight of 100.17 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-(trideuteriomethyl)pyridine. InChIKey: ITQTTZVARXURQS-AAYPNNLASA-N.
| Molecular formula | C6H7N |
|---|---|
| Molecular weight | 100.17 g/mol |
| IUPAC name | 2,3,4,6-tetradeuterio-5-(trideuteriomethyl)pyridine |
| InChIKey | ITQTTZVARXURQS-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)