Products 202529-13-3

CAS 202529-13-3 is the registry number for 3-Methylpyridine-d7, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.

Structural formula: {0} (CAS {1})

2,3,4,6-tetradeuterio-5-(trideuteriomethyl)pyridine (CAS 202529-13-3) is a chemical compound with the molecular formula C6H7N and a molecular weight of 100.17 g/mol. IUPAC name: 2,3,4,6-tetradeuterio-5-(trideuteriomethyl)pyridine. InChIKey: ITQTTZVARXURQS-AAYPNNLASA-N.

Identity
Molecular formulaC6H7N
Molecular weight100.17 g/mol
IUPAC name2,3,4,6-tetradeuterio-5-(trideuteriomethyl)pyridine
InChIKeyITQTTZVARXURQS-AAYPNNLASA-N
SMILES[2H]C1=C(C(=C(N=C1[2H])[2H])C([2H])([2H])[2H])[2H]

Computed by PubChem (NCBI)