CAS 20255-66-7 appears in our catalog under these names: N,N-Dimethylacetamide-2,2,2-d3, 98 atom % D, min 98% Chemical Purity, N,N-Dimethylacetamide-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
2,2,2-trideuterio-N,N-dimethylacetamide (CAS 20255-66-7) is a chemical compound with the molecular formula C4H9NO and a molecular weight of 90.14 g/mol. IUPAC name: 2,2,2-trideuterio-N,N-dimethylacetamide. InChIKey: FXHOOIRPVKKKFG-FIBGUPNXSA-N.
| Molecular formula | C4H9NO |
|---|---|
| Molecular weight | 90.14 g/mol |
| IUPAC name | 2,2,2-trideuterio-N,N-dimethylacetamide |
| InChIKey | FXHOOIRPVKKKFG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)N(C)C |
Computed by PubChem (NCBI)