Products 31591-08-9
CAS 31591-08-9 appears in our catalog under these names: N,N-Dimethyl-d6-acetamide, 99 atom % D, min 98% Chemical Purity, N,N-Dimethylacetamide-d6. Offered by: CDN, MedChemExpress. Available pack sizes: 1g, 0,5g, 1 mg, 5 mg.
N,N-bis(trideuteriomethyl)acetamide (CAS 31591-08-9) is a chemical compound with the molecular formula C4H9NO and a molecular weight of 93.16 g/mol. IUPAC name: N,N-bis(trideuteriomethyl)acetamide. InChIKey: FXHOOIRPVKKKFG-XERRXZQWSA-N.
| Molecular formula | C4H9NO |
|---|---|
| Molecular weight | 93.16 g/mol |
| IUPAC name | N,N-bis(trideuteriomethyl)acetamide |
| InChIKey | FXHOOIRPVKKKFG-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N(C(=O)C)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)