Products 2026076-07-1
CAS 2026076-07-1 is the registry number for 5-Amino-6-(1-(propan-2-yl)-1H-pyrazol-5-yl)piperidin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-amino-6-(2-propan-2-ylpyrazol-3-yl)piperidin-2-one (CAS 2026076-07-1) is a chemical compound with the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. IUPAC name: 5-amino-6-(2-propan-2-ylpyrazol-3-yl)piperidin-2-one. InChIKey: FHFPPYRWXPJTOU-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O |
|---|---|
| Molecular weight | 222.29 g/mol |
| IUPAC name | 5-amino-6-(2-propan-2-ylpyrazol-3-yl)piperidin-2-one |
| InChIKey | FHFPPYRWXPJTOU-UHFFFAOYSA-N |
| SMILES | CC(C)N1C(=CC=N1)C2C(CCC(=O)N2)N |
Computed by PubChem (NCBI)